C15H17N3O — CID 163294861
1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxamide (PubChem CID 163294861) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxamide.
| Compound Name | 1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxamide |
|---|---|
| PubChem CID | 163294861 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxamide |
| SMILES | NC(=O)C1CCc2c(cnn2Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H17N3O/c16-15(19)12-6-7-14-13(8-12)9-17-18(14)10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2,(H2,16,19) |
| InChIKey | MSYAYUQGSDZXLA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |