C17H20N2O2 — CID 129354303
ethyl (5S)-1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxylate (PubChem CID 129354303) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is ethyl (5S)-1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxylate.
| Compound Name | ethyl (5S)-1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 129354303 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | ethyl (5S)-1-benzyl-4,5,6,7-tetrahydroindazole-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCc2c(cnn2Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H20N2O2/c1-2-21-17(20)14-8-9-16-15(10-14)11-18-19(16)12-13-6-4-3-5-7-13/h3-7,11,14H,2,8-10,12H2,1H3/t14-/m0/s1 |
| InChIKey | MAEWNWDJMPXRFT-AWEZNQCLSA-N |
| XLogP | 2.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |