1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride

C15H15ClN2O — CID 164753880

IUPAC1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride
SMILESO=C(Cl)C1CCc2c(cnn2Cc2ccccc2)C1
InChIInChI=1S/C15H15ClN2O/c16-15(19)12-6-7-14-13(8-12)9-17-18(14)10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2
InChIKeyHTFXEFDRTNIGJT-UHFFFAOYSA-N
MW274.75 g/mol
LogP2.80
Rot. Bonds3

About 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride

1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride (PubChem CID 164753880) has the molecular formula C15H15ClN2O and a molecular weight of 274.75 g/mol. Its IUPAC name is 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride.

Molecular Properties

Compound Name1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride
PubChem CID164753880
Molecular FormulaC15H15ClN2O
Molecular Weight274.75 g/mol
Exact Mass274.09
IUPAC Name1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride
SMILESO=C(Cl)C1CCc2c(cnn2Cc2ccccc2)C1
InChIInChI=1S/C15H15ClN2O/c16-15(19)12-6-7-14-13(8-12)9-17-18(14)10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2
InChIKeyHTFXEFDRTNIGJT-UHFFFAOYSA-N
XLogP2.80
TPSA34.89 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.75
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride?
The IUPAC name of 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride (CID 164753880) is 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride.
What is the SMILES notation for 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride?
The canonical SMILES for 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride is O=C(Cl)C1CCc2c(cnn2Cc2ccccc2)C1.
What is the InChIKey of 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride?
The InChIKey is HTFXEFDRTNIGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O/c16-15(19)12-6-7-14-13(8-12)9-17-18(14)10-11-4-2-1-3-5-11/h1-5,9,12H,6-8,10H2.
What are the key properties of 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride?
1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride has a molecular weight of 274.75 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4,5,6,7-tetrahydroindazole-5-carbonyl chloride is sourced from PubChem (CID 164753880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).