C16H21FN4O — CID 163295175
(1R,5S)-8-azabicyclo[3.2.1]octane;N-[(3-fluoro-2H-indazol-5-yl)methyl]formamide (PubChem CID 163295175) has the molecular formula C16H21FN4O and a molecular weight of 304.37 g/mol. Its IUPAC name is (1R,5S)-8-azabicyclo[3.2.1]octane;N-[(3-fluoro-2H-indazol-5-yl)methyl]formamide.
| Compound Name | (1R,5S)-8-azabicyclo[3.2.1]octane;N-[(3-fluoro-2H-indazol-5-yl)methyl]formamide |
|---|---|
| PubChem CID | 163295175 |
| Molecular Formula | C16H21FN4O |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (1R,5S)-8-azabicyclo[3.2.1]octane;N-[(3-fluoro-2H-indazol-5-yl)methyl]formamide |
| SMILES | C1C[C@@H]2CC[C@H](C1)N2.O=CNCc1ccc2n[nH]c(F)c2c1 |
| InChI | InChI=1S/C9H8FN3O.C7H13N/c10-9-7-3-6(4-11-5-14)1-2-8(7)12-13-9;1-2-6-4-5-7(3-1)8-6/h1-3,5H,4H2,(H,11,14)(H,12,13);6-8H,1-5H2/t;6-,7+ |
| InChIKey | CCVSGTFJFZELMQ-DAULDNKOSA-N |
| XLogP | 2.24 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|