C10H19F2NO2 — CID 163295668
4-amino-1-(1,1-difluoro-3-methoxypropyl)cyclohexan-1-ol (PubChem CID 163295668) has the molecular formula C10H19F2NO2 and a molecular weight of 223.26 g/mol. Its IUPAC name is 4-amino-1-(1,1-difluoro-3-methoxypropyl)cyclohexan-1-ol.
| Compound Name | 4-amino-1-(1,1-difluoro-3-methoxypropyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 163295668 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 4-amino-1-(1,1-difluoro-3-methoxypropyl)cyclohexan-1-ol |
| SMILES | COCCC(F)(F)C1(O)CCC(N)CC1 |
| InChI | InChI=1S/C10H19F2NO2/c1-15-7-6-10(11,12)9(14)4-2-8(13)3-5-9/h8,14H,2-7,13H2,1H3 |
| InChIKey | NETHAIMDTYIPIU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |