C11H14N4O3 — CID 163296230
9-[(2R,4R)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-7H-purin-8-one (PubChem CID 163296230) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 9-[(2R,4R)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-7H-purin-8-one.
| Compound Name | 9-[(2R,4R)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 163296230 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 9-[(2R,4R)-5-(hydroxymethyl)-4-methyloxolan-2-yl]-7H-purin-8-one |
| SMILES | C[C@@H]1C[C@H](n2c(=O)[nH]c3cncnc32)OC1CO |
| InChI | InChI=1S/C11H14N4O3/c1-6-2-9(18-8(6)4-16)15-10-7(14-11(15)17)3-12-5-13-10/h3,5-6,8-9,16H,2,4H2,1H3,(H,14,17)/t6-,8?,9-/m1/s1 |
| InChIKey | DDASDNQTLGYGDF-CQTSCFDVSA-N |
| XLogP | 0.04 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |