C11H15N5O3S — CID 141313318
9-(1-methylsulfonylpiperidin-4-yl)-7H-purin-8-one (PubChem CID 141313318) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 9-(1-methylsulfonylpiperidin-4-yl)-7H-purin-8-one.
| Compound Name | 9-(1-methylsulfonylpiperidin-4-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 141313318 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 9-(1-methylsulfonylpiperidin-4-yl)-7H-purin-8-one |
| SMILES | CS(=O)(=O)N1CCC(n2c(=O)[nH]c3cncnc32)CC1 |
| InChI | InChI=1S/C11H15N5O3S/c1-20(18,19)15-4-2-8(3-5-15)16-10-9(14-11(16)17)6-12-7-13-10/h6-8H,2-5H2,1H3,(H,14,17) |
| InChIKey | LNLOZZZQLZXZEF-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |