C20H22ClN7O2 — CID 10025567
9-[1-[3-chloro-5-(pyrrolidine-1-carbonyl)-2-pyridinyl]piperidin-4-yl]-7H-purin-8-one (PubChem CID 10025567) has the molecular formula C20H22ClN7O2 and a molecular weight of 427.90 g/mol. Its IUPAC name is 9-[1-[3-chloro-5-(pyrrolidine-1-carbonyl)-2-pyridinyl]piperidin-4-yl]-7H-purin-8-one.
| Compound Name | 9-[1-[3-chloro-5-(pyrrolidine-1-carbonyl)-2-pyridinyl]piperidin-4-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 10025567 |
| Molecular Formula | C20H22ClN7O2 |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 9-[1-[3-chloro-5-(pyrrolidine-1-carbonyl)-2-pyridinyl]piperidin-4-yl]-7H-purin-8-one |
| SMILES | O=C(c1cnc(N2CCC(n3c(=O)[nH]c4cncnc43)CC2)c(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C20H22ClN7O2/c21-15-9-13(19(29)27-5-1-2-6-27)10-23-17(15)26-7-3-14(4-8-26)28-18-16(25-20(28)30)11-22-12-24-18/h9-12,14H,1-8H2,(H,25,30) |
| InChIKey | ZXCDHVBAYZPRMF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |