C15H15N5O2S — CID 53181148
9-[1-(thiophene-2-carbonyl)piperidin-4-yl]-7H-purin-8-one (PubChem CID 53181148) has the molecular formula C15H15N5O2S and a molecular weight of 329.38 g/mol. Its IUPAC name is 9-[1-(thiophene-2-carbonyl)piperidin-4-yl]-7H-purin-8-one.
| Compound Name | 9-[1-(thiophene-2-carbonyl)piperidin-4-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 53181148 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 9-[1-(thiophene-2-carbonyl)piperidin-4-yl]-7H-purin-8-one |
| SMILES | O=C(c1cccs1)N1CCC(n2c(=O)[nH]c3cncnc32)CC1 |
| InChI | InChI=1S/C15H15N5O2S/c21-14(12-2-1-7-23-12)19-5-3-10(4-6-19)20-13-11(18-15(20)22)8-16-9-17-13/h1-2,7-10H,3-6H2,(H,18,22) |
| InChIKey | KEVBOFRITMHYFT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |