C16H17N5O2S — CID 53181149
9-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]-7H-purin-8-one (PubChem CID 53181149) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is 9-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]-7H-purin-8-one.
| Compound Name | 9-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 53181149 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 9-[1-(2-thiophen-2-ylacetyl)piperidin-4-yl]-7H-purin-8-one |
| SMILES | O=C(Cc1cccs1)N1CCC(n2c(=O)[nH]c3cncnc32)CC1 |
| InChI | InChI=1S/C16H17N5O2S/c22-14(8-12-2-1-7-24-12)20-5-3-11(4-6-20)21-15-13(19-16(21)23)9-17-10-18-15/h1-2,7,9-11H,3-6,8H2,(H,19,23) |
| InChIKey | UVFMGEUQWHXVOD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |