C13H13N5O2 — CID 175848647
9-(1-but-2-ynoylpyrrolidin-3-yl)-7H-purin-8-one (PubChem CID 175848647) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 9-(1-but-2-ynoylpyrrolidin-3-yl)-7H-purin-8-one.
| Compound Name | 9-(1-but-2-ynoylpyrrolidin-3-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 175848647 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 9-(1-but-2-ynoylpyrrolidin-3-yl)-7H-purin-8-one |
| SMILES | CC#CC(=O)N1CCC(n2c(=O)[nH]c3cncnc32)C1 |
| InChI | InChI=1S/C13H13N5O2/c1-2-3-11(19)17-5-4-9(7-17)18-12-10(16-13(18)20)6-14-8-15-12/h6,8-9H,4-5,7H2,1H3,(H,16,20) |
| InChIKey | UXQBDINJLHKLFM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|