C14H14N6O3S — CID 95105404
9-[(3S)-1-pyridin-3-ylsulfonylpyrrolidin-3-yl]-7H-purin-8-one (PubChem CID 95105404) has the molecular formula C14H14N6O3S and a molecular weight of 346.37 g/mol. Its IUPAC name is 9-[(3S)-1-pyridin-3-ylsulfonylpyrrolidin-3-yl]-7H-purin-8-one.
| Compound Name | 9-[(3S)-1-pyridin-3-ylsulfonylpyrrolidin-3-yl]-7H-purin-8-one |
|---|---|
| PubChem CID | 95105404 |
| Molecular Formula | C14H14N6O3S |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 9-[(3S)-1-pyridin-3-ylsulfonylpyrrolidin-3-yl]-7H-purin-8-one |
| SMILES | O=c1[nH]c2cncnc2n1[C@H]1CCN(S(=O)(=O)c2cccnc2)C1 |
| InChI | InChI=1S/C14H14N6O3S/c21-14-18-12-7-16-9-17-13(12)20(14)10-3-5-19(8-10)24(22,23)11-2-1-4-15-6-11/h1-2,4,6-7,9-10H,3,5,8H2,(H,18,21)/t10-/m0/s1 |
| InChIKey | ARDQOHDKWPAGHM-JTQLQIEISA-N |
| XLogP | 0.15 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |