C9H14BrF2NO3 — CID 163297712
methyl (2S,3S)-2-[(2-bromo-2,2-difluoroacetyl)amino]-3-methylpentanoate (PubChem CID 163297712) has the molecular formula C9H14BrF2NO3 and a molecular weight of 302.12 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(2-bromo-2,2-difluoroacetyl)amino]-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[(2-bromo-2,2-difluoroacetyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 163297712 |
| Molecular Formula | C9H14BrF2NO3 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | methyl (2S,3S)-2-[(2-bromo-2,2-difluoroacetyl)amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(F)(F)Br)C(=O)OC |
| InChI | InChI=1S/C9H14BrF2NO3/c1-4-5(2)6(7(14)16-3)13-8(15)9(10,11)12/h5-6H,4H2,1-3H3,(H,13,15)/t5-,6-/m0/s1 |
| InChIKey | GSHLNAHPQGDFEX-WDSKDSINSA-N |
| XLogP | 1.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|