C19H15FN4O2S — CID 163298807
9-(2-fluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylic acid (PubChem CID 163298807) has the molecular formula C19H15FN4O2S and a molecular weight of 382.42 g/mol. Its IUPAC name is 9-(2-fluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylic acid.
| Compound Name | 9-(2-fluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylic acid |
|---|---|
| PubChem CID | 163298807 |
| Molecular Formula | C19H15FN4O2S |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 9-(2-fluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylic acid |
| SMILES | Cc1nnc2n1-c1sc3c(c1C(c1ccccc1F)=NC2)CC(C(=O)O)C3 |
| InChI | InChI=1S/C19H15FN4O2S/c1-9-22-23-15-8-21-17(11-4-2-3-5-13(11)20)16-12-6-10(19(25)26)7-14(12)27-18(16)24(9)15/h2-5,10H,6-8H2,1H3,(H,25,26) |
| InChIKey | UYQOYEPXTAKMMP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |