C19H16F2N4OS — CID 167452204
[9-(2,6-difluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaen-14-yl]methanol (PubChem CID 167452204) has the molecular formula C19H16F2N4OS and a molecular weight of 386.43 g/mol. Its IUPAC name is [9-(2,6-difluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaen-14-yl]methanol.
| Compound Name | [9-(2,6-difluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaen-14-yl]methanol |
|---|---|
| PubChem CID | 167452204 |
| Molecular Formula | C19H16F2N4OS |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [9-(2,6-difluorophenyl)-3-methyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaen-14-yl]methanol |
| SMILES | Cc1nnc2n1-c1sc3c(c1C(c1c(F)cccc1F)=NC2)CCC3CO |
| InChI | InChI=1S/C19H16F2N4OS/c1-9-23-24-14-7-22-17(16-12(20)3-2-4-13(16)21)15-11-6-5-10(8-26)18(11)27-19(15)25(9)14/h2-4,10,26H,5-8H2,1H3 |
| InChIKey | WTZNMNPJRSWPDE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |