C20H18N4O2S — CID 14071270
methyl 3-methyl-9-phenyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylate (PubChem CID 14071270) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is methyl 3-methyl-9-phenyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylate.
| Compound Name | methyl 3-methyl-9-phenyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylate |
|---|---|
| PubChem CID | 14071270 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | methyl 3-methyl-9-phenyl-16-thia-2,4,5,8-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-1(10),3,5,8,11(15)-pentaene-13-carboxylate |
| SMILES | COC(=O)C1Cc2sc3c(c2C1)C(c1ccccc1)=NCc1nnc(C)n1-3 |
| InChI | InChI=1S/C20H18N4O2S/c1-11-22-23-16-10-21-18(12-6-4-3-5-7-12)17-14-8-13(20(25)26-2)9-15(14)27-19(17)24(11)16/h3-7,13H,8-10H2,1-2H3 |
| InChIKey | IHMLJLXOWZBUOE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |