C12H21N3 — CID 163302570
(E)-2-(4-methyl-4,5-dihydro-1H-pyrazol-5-yl)oct-2-en-1-imine (PubChem CID 163302570) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is (E)-2-(4-methyl-4,5-dihydro-1H-pyrazol-5-yl)oct-2-en-1-imine.
| Compound Name | (E)-2-(4-methyl-4,5-dihydro-1H-pyrazol-5-yl)oct-2-en-1-imine |
|---|---|
| PubChem CID | 163302570 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (E)-2-(4-methyl-4,5-dihydro-1H-pyrazol-5-yl)oct-2-en-1-imine |
| SMILES | [H]/N=C/C(=C/CCCCC)C1NN=CC1C |
| InChI | InChI=1S/C12H21N3/c1-3-4-5-6-7-11(8-13)12-10(2)9-14-15-12/h7-10,12-13,15H,3-6H2,1-2H3/b11-7-,13-8+ |
| InChIKey | NJVPAKCRNQCMCW-JKNYEHFOSA-N |
| XLogP | 2.74 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|