About 2-iodooct-2-enal
2-iodooct-2-enal (PubChem CID 74960497) has the molecular formula C8H13IO
and a molecular weight of 252.09 g/mol. Its IUPAC name is 2-iodooct-2-enal.
Molecular Properties
| Compound Name | 2-iodooct-2-enal |
| PubChem CID | 74960497 |
| Molecular Formula | C8H13IO |
| Molecular Weight | 252.09 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 2-iodooct-2-enal |
| SMILES | CCCCCC=C(I)C=O |
| InChI | InChI=1S/C8H13IO/c1-2-3-4-5-6-8(9)7-10/h6-7H,2-5H2,1H3 |
| InChIKey | LIXVJKMJYLAFPZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iodooct-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodooct-2-enal?
The IUPAC name of 2-iodooct-2-enal (CID 74960497) is 2-iodooct-2-enal.
What is the SMILES notation for 2-iodooct-2-enal?
The canonical SMILES for 2-iodooct-2-enal is CCCCCC=C(I)C=O.
What is the InChIKey of 2-iodooct-2-enal?
The InChIKey is LIXVJKMJYLAFPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13IO/c1-2-3-4-5-6-8(9)7-10/h6-7H,2-5H2,1H3.
What are the key properties of 2-iodooct-2-enal?
2-iodooct-2-enal has a molecular weight of 252.09 g/mol, XLogP of 3.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodooct-2-enal is sourced from PubChem (CID 74960497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).