C15H9ClF2N6 — CID 163302647
8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaene (PubChem CID 163302647) has the molecular formula C15H9ClF2N6 and a molecular weight of 346.73 g/mol. Its IUPAC name is 8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaene.
| Compound Name | 8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaene |
|---|---|
| PubChem CID | 163302647 |
| Molecular Formula | C15H9ClF2N6 |
| Molecular Weight | 346.73 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 8-(3-chloro-2,6-difluorophenyl)-3,4,7,9,12,13-hexazatetracyclo[7.5.1.02,6.012,15]pentadeca-1(15),2(6),4,7,13-pentaene |
| SMILES | Fc1ccc(Cl)c(F)c1C1=Nc2cn[nH]c2-c2cnn3c2N1CC3 |
| InChI | InChI=1S/C15H9ClF2N6/c16-8-1-2-9(17)11(12(8)18)14-21-10-6-19-22-13(10)7-5-20-24-4-3-23(14)15(7)24/h1-2,5-6H,3-4H2,(H,19,22) |
| InChIKey | NMXSUBWPUGWLRL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.73 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|