C16H13ClF2N6 — CID 163302571
8-(4-chloro-2,6-difluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,14-tetraene (PubChem CID 163302571) has the molecular formula C16H13ClF2N6 and a molecular weight of 362.77 g/mol. Its IUPAC name is 8-(4-chloro-2,6-difluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,14-tetraene.
| Compound Name | 8-(4-chloro-2,6-difluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,14-tetraene |
|---|---|
| PubChem CID | 163302571 |
| Molecular Formula | C16H13ClF2N6 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 8-(4-chloro-2,6-difluorophenyl)-3,4,7,9,13,14-hexazatetracyclo[7.6.1.02,6.013,16]hexadeca-1(16),2(6),4,14-tetraene |
| SMILES | Fc1cc(Cl)cc(F)c1C1Nc2cn[nH]c2-c2cnn3c2N1CCC3 |
| InChI | InChI=1S/C16H13ClF2N6/c17-8-4-10(18)13(11(19)5-8)15-22-12-7-20-23-14(12)9-6-21-25-3-1-2-24(15)16(9)25/h4-7,15,22H,1-3H2,(H,20,23) |
| InChIKey | STLRDWNPFHOTOK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |