C17H21N3O — CID 163306506
4,5,6-trimethyl-2-[(3R)-3-phenoxypyrrolidin-1-yl]pyrimidine (PubChem CID 163306506) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 4,5,6-trimethyl-2-[(3R)-3-phenoxypyrrolidin-1-yl]pyrimidine.
| Compound Name | 4,5,6-trimethyl-2-[(3R)-3-phenoxypyrrolidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 163306506 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 4,5,6-trimethyl-2-[(3R)-3-phenoxypyrrolidin-1-yl]pyrimidine |
| SMILES | Cc1nc(N2CC[C@@H](Oc3ccccc3)C2)nc(C)c1C |
| InChI | InChI=1S/C17H21N3O/c1-12-13(2)18-17(19-14(12)3)20-10-9-16(11-20)21-15-7-5-4-6-8-15/h4-8,16H,9-11H2,1-3H3/t16-/m1/s1 |
| InChIKey | GHIHVDXMBWKHPV-MRXNPFEDSA-N |
| XLogP | 3.06 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |