C15H19N5O3 — CID 166602870
2,4-dimethoxy-6-(3-pyridin-3-yloxypiperidin-1-yl)-1,3,5-triazine (PubChem CID 166602870) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(3-pyridin-3-yloxypiperidin-1-yl)-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-(3-pyridin-3-yloxypiperidin-1-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 166602870 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2,4-dimethoxy-6-(3-pyridin-3-yloxypiperidin-1-yl)-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(N2CCCC(Oc3cccnc3)C2)n1 |
| InChI | InChI=1S/C15H19N5O3/c1-21-14-17-13(18-15(19-14)22-2)20-8-4-6-12(10-20)23-11-5-3-7-16-9-11/h3,5,7,9,12H,4,6,8,10H2,1-2H3 |
| InChIKey | GDZMGFRVEGNYTG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 82.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |