C17H21NO5S — CID 163306745
(3aS,6aR)-5-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one (PubChem CID 163306745) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is (3aS,6aR)-5-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one.
| Compound Name | (3aS,6aR)-5-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 163306745 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (3aS,6aR)-5-[(4-methoxy-5,6,7,8-tetrahydronaphthalen-1-yl)sulfonyl]-3a,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3-one |
| SMILES | COc1ccc(S(=O)(=O)N2C[C@@H]3COC(=O)[C@@H]3C2)c2c1CCCC2 |
| InChI | InChI=1S/C17H21NO5S/c1-22-15-6-7-16(13-5-3-2-4-12(13)15)24(20,21)18-8-11-10-23-17(19)14(11)9-18/h6-7,11,14H,2-5,8-10H2,1H3/t11-,14-/m1/s1 |
| InChIKey | YEPZMWDSZGVOBP-BXUZGUMPSA-N |
| XLogP | 1.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |