C22H31N3O3 — CID 163310388
(1R,2S,8S,9S)-8-(3-methylbutyl)-11-(2-oxo-1H-pyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 163310388) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(2-oxo-1H-pyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(2-oxo-1H-pyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 163310388 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (1R,2S,8S,9S)-8-(3-methylbutyl)-11-(2-oxo-1H-pyridine-3-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(C(=O)c3ccc[nH]c3=O)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C22H31N3O3/c1-14(2)8-9-19-16-11-15(18-6-3-7-20(26)25(18)19)12-24(13-16)22(28)17-5-4-10-23-21(17)27/h4-5,10,14-16,18-19H,3,6-9,11-13H2,1-2H3,(H,23,27)/t15-,16+,18+,19+/m1/s1 |
| InChIKey | DNFCKGNDGHYLDI-NEPXVJNWSA-N |
| XLogP | 2.65 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |