C21H31N3O3 — CID 70724530
(4aS,8aR)-1-(3-methylbutyl)-6-[3-(2-oxo-1-pyridinyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70724530) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-methylbutyl)-6-[3-(2-oxo-1-pyridinyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-methylbutyl)-6-[3-(2-oxo-1-pyridinyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70724530 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (4aS,8aR)-1-(3-methylbutyl)-6-[3-(2-oxo-1-pyridinyl)propanoyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC(C)CCN1C(=O)CC[C@H]2CN(C(=O)CCn3ccccc3=O)CC[C@H]21 |
| InChI | InChI=1S/C21H31N3O3/c1-16(2)8-14-24-18-9-12-23(15-17(18)6-7-21(24)27)20(26)10-13-22-11-4-3-5-19(22)25/h3-5,11,16-18H,6-10,12-15H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | RFBDIBFVOWCZDE-ZWKOTPCHSA-N |
| XLogP | 2.12 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |