C20H29N3O3 — CID 56884849
(4aS,8aR)-1-(3-methylbutyl)-6-(1-methyl-2-oxopyridine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 56884849) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-methylbutyl)-6-(1-methyl-2-oxopyridine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-methylbutyl)-6-(1-methyl-2-oxopyridine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 56884849 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (4aS,8aR)-1-(3-methylbutyl)-6-(1-methyl-2-oxopyridine-4-carbonyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC(C)CCN1C(=O)CC[C@H]2CN(C(=O)c3ccn(C)c(=O)c3)CC[C@H]21 |
| InChI | InChI=1S/C20H29N3O3/c1-14(2)6-11-23-17-8-10-22(13-16(17)4-5-18(23)24)20(26)15-7-9-21(3)19(25)12-15/h7,9,12,14,16-17H,4-6,8,10-11,13H2,1-3H3/t16-,17+/m0/s1 |
| InChIKey | CMQOKOKZGSNJKM-DLBZAZTESA-N |
| XLogP | 1.88 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |