C21H24N2O2 — CID 163310411
3-[3-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 163310411) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 3-[3-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[3-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 163310411 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 3-[3-(4-benzyl-1,3-oxazol-5-yl)phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1cccc(-c2ocnc2Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-23(2)12-7-13-24-19-11-6-10-18(15-19)21-20(22-16-25-21)14-17-8-4-3-5-9-17/h3-6,8-11,15-16H,7,12-14H2,1-2H3 |
| InChIKey | JIZNJDCXEOMIEL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|