C26H28N6O5 — CID 163310737
(3R,8S)-6-(6-aminopyrimidin-4-yl)-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione (PubChem CID 163310737) has the molecular formula C26H28N6O5 and a molecular weight of 504.55 g/mol. Its IUPAC name is (3R,8S)-6-(6-aminopyrimidin-4-yl)-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione.
| Compound Name | (3R,8S)-6-(6-aminopyrimidin-4-yl)-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 163310737 |
| Molecular Formula | C26H28N6O5 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | (3R,8S)-6-(6-aminopyrimidin-4-yl)-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.2.2.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1ccc(cc1)O[C@@H]1CCN(c3cc(N)ncn3)C[C@@H]1NC2=O |
| InChI | InChI=1S/C26H28N6O5/c1-35-21-7-4-17-10-22(21)36-14-25(33)28-12-16-2-5-18(6-3-16)37-20-8-9-32(13-19(20)31-26(17)34)24-11-23(27)29-15-30-24/h2-7,10-11,15,19-20H,8-9,12-14H2,1H3,(H,28,33)(H,31,34)(H2,27,29,30)/t19-,20+/m0/s1 |
| InChIKey | NZSCBHHIYLOYKN-VQTJNVASSA-N |
| XLogP | 1.53 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |