C31H29FN4O5 — CID 164698208
(3R,8S)-23-fluoro-6-isoquinolin-1-yl-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione (PubChem CID 164698208) has the molecular formula C31H29FN4O5 and a molecular weight of 556.59 g/mol. Its IUPAC name is (3R,8S)-23-fluoro-6-isoquinolin-1-yl-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione.
| Compound Name | (3R,8S)-23-fluoro-6-isoquinolin-1-yl-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
|---|---|
| PubChem CID | 164698208 |
| Molecular Formula | C31H29FN4O5 |
| Molecular Weight | 556.59 g/mol |
| Exact Mass | 556.21 |
| IUPAC Name | (3R,8S)-23-fluoro-6-isoquinolin-1-yl-14-methoxy-2,16-dioxa-6,9,19-triazatetracyclo[19.3.1.111,15.03,8]hexacosa-1(24),11(26),12,14,21(25),22-hexaene-10,18-dione |
| SMILES | COc1ccc2cc1OCC(=O)NCc1cc(F)cc(c1)O[C@@H]1CCN(c3nccc4ccccc34)C[C@@H]1NC2=O |
| InChI | InChI=1S/C31H29FN4O5/c1-39-27-7-6-21-14-28(27)40-18-29(37)34-16-19-12-22(32)15-23(13-19)41-26-9-11-36(17-25(26)35-31(21)38)30-24-5-3-2-4-20(24)8-10-33-30/h2-8,10,12-15,25-26H,9,11,16-18H2,1H3,(H,34,37)(H,35,38)/t25-,26+/m0/s1 |
| InChIKey | OLHCFFGAJRNBOJ-IZZNHLLZSA-N |
| XLogP | 3.85 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |