C13H14ClN3O3 — CID 163314238
3-(3-aminopropylamino)-5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 163314238) has the molecular formula C13H14ClN3O3 and a molecular weight of 295.73 g/mol. Its IUPAC name is 3-(3-aminopropylamino)-5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-(3-aminopropylamino)-5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 163314238 |
| Molecular Formula | C13H14ClN3O3 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 3-(3-aminopropylamino)-5-(4-chlorophenyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | NCCCNc1noc(-c2ccc(Cl)cc2)c1C(=O)O |
| InChI | InChI=1S/C13H14ClN3O3/c14-9-4-2-8(3-5-9)11-10(13(18)19)12(17-20-11)16-7-1-6-15/h2-5H,1,6-7,15H2,(H,16,17)(H,18,19) |
| InChIKey | NELQFTMXKAUFDN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|