C17H21ClN4O3 — CID 135114962
5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3S)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide (PubChem CID 135114962) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3S)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3S)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 135114962 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3S)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide |
| SMILES | COCCNc1noc(-c2ccc(Cl)cc2)c1C(=O)N[C@H]1CCNC1 |
| InChI | InChI=1S/C17H21ClN4O3/c1-24-9-8-20-16-14(17(23)21-13-6-7-19-10-13)15(25-22-16)11-2-4-12(18)5-3-11/h2-5,13,19H,6-10H2,1H3,(H,20,22)(H,21,23)/t13-/m0/s1 |
| InChIKey | IENAZVGZMWNDGD-ZDUSSCGKSA-N |
| XLogP | 2.14 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|