C20H26ClN3O5 — CID 135101386
[4,4-bis(hydroxymethyl)piperidin-1-yl]-[5-(4-chlorophenyl)-3-(2-methoxyethylamino)-1,2-oxazol-4-yl]methanone (PubChem CID 135101386) has the molecular formula C20H26ClN3O5 and a molecular weight of 423.90 g/mol. Its IUPAC name is [4,4-bis(hydroxymethyl)piperidin-1-yl]-[5-(4-chlorophenyl)-3-(2-methoxyethylamino)-1,2-oxazol-4-yl]methanone.
| Compound Name | [4,4-bis(hydroxymethyl)piperidin-1-yl]-[5-(4-chlorophenyl)-3-(2-methoxyethylamino)-1,2-oxazol-4-yl]methanone |
|---|---|
| PubChem CID | 135101386 |
| Molecular Formula | C20H26ClN3O5 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | [4,4-bis(hydroxymethyl)piperidin-1-yl]-[5-(4-chlorophenyl)-3-(2-methoxyethylamino)-1,2-oxazol-4-yl]methanone |
| SMILES | COCCNc1noc(-c2ccc(Cl)cc2)c1C(=O)N1CCC(CO)(CO)CC1 |
| InChI | InChI=1S/C20H26ClN3O5/c1-28-11-8-22-18-16(17(29-23-18)14-2-4-15(21)5-3-14)19(27)24-9-6-20(12-25,13-26)7-10-24/h2-5,25-26H,6-13H2,1H3,(H,22,23) |
| InChIKey | XHWINASGODVBAB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|