C17H22Cl2N4O3 — CID 154918302
5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3R)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide;hydrochloride (PubChem CID 154918302) has the molecular formula C17H22Cl2N4O3 and a molecular weight of 401.29 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3R)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide;hydrochloride.
| Compound Name | 5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3R)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 154918302 |
| Molecular Formula | C17H22Cl2N4O3 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 5-(4-chlorophenyl)-3-(2-methoxyethylamino)-N-[(3R)-pyrrolidin-3-yl]-1,2-oxazole-4-carboxamide;hydrochloride |
| SMILES | COCCNc1noc(-c2ccc(Cl)cc2)c1C(=O)N[C@@H]1CCNC1.Cl |
| InChI | InChI=1S/C17H21ClN4O3.ClH/c1-24-9-8-20-16-14(17(23)21-13-6-7-19-10-13)15(25-22-16)11-2-4-12(18)5-3-11;/h2-5,13,19H,6-10H2,1H3,(H,20,22)(H,21,23);1H/t13-;/m1./s1 |
| InChIKey | UUAWOSFNIUEFMA-BTQNPOSSSA-N |
| XLogP | 2.57 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|