C19H24ClN3O3 — CID 135108941
5-(4-chlorophenyl)-N-(cyclobutylmethyl)-3-(2-methoxyethylamino)-N-methyl-1,2-oxazole-4-carboxamide (PubChem CID 135108941) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(cyclobutylmethyl)-3-(2-methoxyethylamino)-N-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(cyclobutylmethyl)-3-(2-methoxyethylamino)-N-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 135108941 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(cyclobutylmethyl)-3-(2-methoxyethylamino)-N-methyl-1,2-oxazole-4-carboxamide |
| SMILES | COCCNc1noc(-c2ccc(Cl)cc2)c1C(=O)N(C)CC1CCC1 |
| InChI | InChI=1S/C19H24ClN3O3/c1-23(12-13-4-3-5-13)19(24)16-17(14-6-8-15(20)9-7-14)26-22-18(16)21-10-11-25-2/h6-9,13H,3-5,10-12H2,1-2H3,(H,21,22) |
| InChIKey | XNODYEYSNGILAP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|