C24H21FN4O — CID 163316198
[4-(5-fluoroquinolin-3-yl)phenyl]-[3-(1H-imidazol-2-yl)piperidin-1-yl]methanone (PubChem CID 163316198) has the molecular formula C24H21FN4O and a molecular weight of 400.46 g/mol. Its IUPAC name is [4-(5-fluoroquinolin-3-yl)phenyl]-[3-(1H-imidazol-2-yl)piperidin-1-yl]methanone.
| Compound Name | [4-(5-fluoroquinolin-3-yl)phenyl]-[3-(1H-imidazol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 163316198 |
| Molecular Formula | C24H21FN4O |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [4-(5-fluoroquinolin-3-yl)phenyl]-[3-(1H-imidazol-2-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2cnc3cccc(F)c3c2)cc1)N1CCCC(c2ncc[nH]2)C1 |
| InChI | InChI=1S/C24H21FN4O/c25-21-4-1-5-22-20(21)13-19(14-28-22)16-6-8-17(9-7-16)24(30)29-12-2-3-18(15-29)23-26-10-11-27-23/h1,4-11,13-14,18H,2-3,12,15H2,(H,26,27) |
| InChIKey | FXVIUXXBEPSWDH-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |