C23H34N4O2 — CID 163316255
5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyrimidin-6-one (PubChem CID 163316255) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyrimidin-6-one.
| Compound Name | 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 163316255 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-1H-pyrimidin-6-one |
| SMILES | O=C(c1cnc[nH]c1=O)N1C[C@H]2C[C@@H](C1)[C@H](CC1CCCCC1)N1CCCC[C@@H]21 |
| InChI | InChI=1S/C23H34N4O2/c28-22-19(12-24-15-25-22)23(29)26-13-17-11-18(14-26)21(10-16-6-2-1-3-7-16)27-9-5-4-8-20(17)27/h12,15-18,20-21H,1-11,13-14H2,(H,24,25,28)/t17-,18+,20+,21+/m1/s1 |
| InChIKey | CHZDFOZUOIEOBC-ZFMNYDKASA-N |
| XLogP | 3.06 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |