C24H36N4O2 — CID 163318296
5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-2-methyl-1H-pyrimidin-6-one (PubChem CID 163318296) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-2-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-2-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 163318296 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | 5-[(1R,2S,8S,9S)-8-(cyclohexylmethyl)-7,11-diazatricyclo[7.3.1.02,7]tridecane-11-carbonyl]-2-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1ncc(C(=O)N2C[C@H]3C[C@@H](C2)[C@H](CC2CCCCC2)N2CCCC[C@@H]32)c(=O)[nH]1 |
| InChI | InChI=1S/C24H36N4O2/c1-16-25-13-20(23(29)26-16)24(30)27-14-18-12-19(15-27)22(11-17-7-3-2-4-8-17)28-10-6-5-9-21(18)28/h13,17-19,21-22H,2-12,14-15H2,1H3,(H,25,26,29)/t18-,19+,21+,22+/m1/s1 |
| InChIKey | JCOYYIIOGMERQO-WAGURGNTSA-N |
| XLogP | 3.36 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |