C23H32N4O3 — CID 164690179
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidine-5-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164690179) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidine-5-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidine-5-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164690179 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidine-5-carbonyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C(c1cnc[nH]c1=O)N1C[C@H]2C[C@@H](C1)[C@H](CC1CCCCC1)N1C(=O)CCC[C@@H]21 |
| InChI | InChI=1S/C23H32N4O3/c28-21-8-4-7-19-16-10-17(20(27(19)21)9-15-5-2-1-3-6-15)13-26(12-16)23(30)18-11-24-14-25-22(18)29/h11,14-17,19-20H,1-10,12-13H2,(H,24,25,29)/t16-,17+,19+,20+/m1/s1 |
| InChIKey | DECUCJQGTDLPTG-UMGGQSCQSA-N |
| XLogP | 2.58 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |