C22H32N4O2 — CID 164692125
(1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164692125) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164692125 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (1R,2S,8S,9S)-8-(cyclohexylmethyl)-11-(6-oxo-1H-pyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C1CCC[C@H]2[C@@H]3C[C@@H](CN(c4cc(=O)[nH]cn4)C3)[C@H](CC3CCCCC3)N12 |
| InChI | InChI=1S/C22H32N4O2/c27-21-11-20(23-14-24-21)25-12-16-10-17(13-25)19(9-15-5-2-1-3-6-15)26-18(16)7-4-8-22(26)28/h11,14-19H,1-10,12-13H2,(H,23,24,27)/t16-,17+,18+,19+/m1/s1 |
| InChIKey | SIZMGFDDFCGBBK-XWSJACJDSA-N |
| XLogP | 2.95 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |