C20H31N5O2 — CID 164700017
(1R,2S,8S,9S)-11-(2-amino-6-oxo-1H-pyrimidin-4-yl)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 164700017) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-(2-amino-6-oxo-1H-pyrimidin-4-yl)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-(2-amino-6-oxo-1H-pyrimidin-4-yl)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 164700017 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | (1R,2S,8S,9S)-11-(2-amino-6-oxo-1H-pyrimidin-4-yl)-8-(3-methylbutyl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)CC[C@H]1[C@H]2C[C@H](CN(c3cc(=O)[nH]c(N)n3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C20H31N5O2/c1-12(2)6-7-16-14-8-13(15-4-3-5-19(27)25(15)16)10-24(11-14)17-9-18(26)23-20(21)22-17/h9,12-16H,3-8,10-11H2,1-2H3,(H3,21,22,23,26)/t13-,14+,15+,16+/m1/s1 |
| InChIKey | TUYNMGQPMGGZRM-UGUYLWEFSA-N |
| XLogP | 1.99 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |