C21H29Cl2N5O2 — CID 171325028
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;dihydrochloride (PubChem CID 171325028) has the molecular formula C21H29Cl2N5O2 and a molecular weight of 454.40 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 171325028 |
| Molecular Formula | C21H29Cl2N5O2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-4-oxopyrido[1,2-a]pyrimidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC[C@H]1[C@@H]2CNC[C@@H](C2)[C@@H]2CCCCN21)c1cnc2ccccn2c1=O |
| InChI | InChI=1S/C21H27N5O2.2ClH/c27-20(16-12-23-19-6-2-4-8-26(19)21(16)28)24-13-18-15-9-14(10-22-11-15)17-5-1-3-7-25(17)18;;/h2,4,6,8,12,14-15,17-18,22H,1,3,5,7,9-11,13H2,(H,24,27);2*1H/t14-,15+,17+,18+;;/m1../s1 |
| InChIKey | XRPBLPZILFHTCE-FNVPIGCZSA-N |
| XLogP | 1.73 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |