C18H28Cl2N4O2 — CID 171324874
N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide;dihydrochloride (PubChem CID 171324874) has the molecular formula C18H28Cl2N4O2 and a molecular weight of 403.35 g/mol. Its IUPAC name is N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 171324874 |
| Molecular Formula | C18H28Cl2N4O2 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N-[[(1R,2S,8R,9S)-7,11-diazatricyclo[7.3.1.02,7]tridecan-8-yl]methyl]-2-oxo-1H-pyridine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NC[C@H]1[C@@H]2CNC[C@@H](C2)[C@@H]2CCCCN21)c1ccc[nH]c1=O |
| InChI | InChI=1S/C18H26N4O2.2ClH/c23-17-14(4-3-6-20-17)18(24)21-11-16-13-8-12(9-19-10-13)15-5-1-2-7-22(15)16;;/h3-4,6,12-13,15-16,19H,1-2,5,7-11H2,(H,20,23)(H,21,24);2*1H/t12-,13+,15+,16+;;/m1../s1 |
| InChIKey | GDARBFPEAKRCKH-ZTDVEMGNSA-N |
| XLogP | 1.41 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |