C21H40O3Si — CID 163319751
[(4R,6E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethylundeca-6,10-dien-4-yl] acetate (PubChem CID 163319751) has the molecular formula C21H40O3Si and a molecular weight of 368.63 g/mol. Its IUPAC name is [(4R,6E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethylundeca-6,10-dien-4-yl] acetate.
| Compound Name | [(4R,6E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethylundeca-6,10-dien-4-yl] acetate |
|---|---|
| PubChem CID | 163319751 |
| Molecular Formula | C21H40O3Si |
| Molecular Weight | 368.63 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | [(4R,6E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-6,9-dimethylundeca-6,10-dien-4-yl] acetate |
| SMILES | C=C[C@H](C)[C@@H](/C=C(\C)C[C@@H](CCC)OC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O3Si/c1-11-13-19(23-18(5)22)14-16(3)15-20(17(4)12-2)24-25(9,10)21(6,7)8/h12,15,17,19-20H,2,11,13-14H2,1,3-10H3/b16-15+/t17-,19+,20+/m0/s1 |
| InChIKey | DMMPWVLLHBWVQL-GDSSIJOBSA-N |
| XLogP | 6.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|