C14H26ClN3O3 — CID 163321355
ethyl 2-[4-(5-aminopentoxy)pyrazol-1-yl]-2-methylpropanoate;hydrochloride (PubChem CID 163321355) has the molecular formula C14H26ClN3O3 and a molecular weight of 319.83 g/mol. Its IUPAC name is ethyl 2-[4-(5-aminopentoxy)pyrazol-1-yl]-2-methylpropanoate;hydrochloride.
| Compound Name | ethyl 2-[4-(5-aminopentoxy)pyrazol-1-yl]-2-methylpropanoate;hydrochloride |
|---|---|
| PubChem CID | 163321355 |
| Molecular Formula | C14H26ClN3O3 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | ethyl 2-[4-(5-aminopentoxy)pyrazol-1-yl]-2-methylpropanoate;hydrochloride |
| SMILES | CCOC(=O)C(C)(C)n1cc(OCCCCCN)cn1.Cl |
| InChI | InChI=1S/C14H25N3O3.ClH/c1-4-19-13(18)14(2,3)17-11-12(10-16-17)20-9-7-5-6-8-15;/h10-11H,4-9,15H2,1-3H3;1H |
| InChIKey | VICNKAKNUAPXGQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|