C14H24N4O3 — CID 171364862
2-[4-(2-aminoethoxy)pyrazol-1-yl]-2-methyl-N-(oxan-4-yl)propanamide (PubChem CID 171364862) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[4-(2-aminoethoxy)pyrazol-1-yl]-2-methyl-N-(oxan-4-yl)propanamide.
| Compound Name | 2-[4-(2-aminoethoxy)pyrazol-1-yl]-2-methyl-N-(oxan-4-yl)propanamide |
|---|---|
| PubChem CID | 171364862 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[4-(2-aminoethoxy)pyrazol-1-yl]-2-methyl-N-(oxan-4-yl)propanamide |
| SMILES | CC(C)(C(=O)NC1CCOCC1)n1cc(OCCN)cn1 |
| InChI | InChI=1S/C14H24N4O3/c1-14(2,13(19)17-11-3-6-20-7-4-11)18-10-12(9-16-18)21-8-5-15/h9-11H,3-8,15H2,1-2H3,(H,17,19) |
| InChIKey | NAMCXYXVXOJMMC-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |