C23H20N2O5 — CID 163321775
6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-phenylquinazoline-2,4-dione (PubChem CID 163321775) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-phenylquinazoline-2,4-dione.
| Compound Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-phenylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 163321775 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 6-[(2,6-dioxocyclohexylidene)-hydroxymethyl]-1,5-dimethyl-3-phenylquinazoline-2,4-dione |
| SMILES | Cc1c(C(O)=C2C(=O)CCCC2=O)ccc2c1c(=O)n(-c1ccccc1)c(=O)n2C |
| InChI | InChI=1S/C23H20N2O5/c1-13-15(21(28)20-17(26)9-6-10-18(20)27)11-12-16-19(13)22(29)25(23(30)24(16)2)14-7-4-3-5-8-14/h3-5,7-8,11-12,28H,6,9-10H2,1-2H3 |
| InChIKey | MGESDYCBGZPGIH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|