C31H28O3Si — CID 163323298
2-trimethylsilyloxy-5-(1,2,2-triphenylethenyl)benzene-1,3-dicarbaldehyde (PubChem CID 163323298) has the molecular formula C31H28O3Si and a molecular weight of 476.65 g/mol. Its IUPAC name is 2-trimethylsilyloxy-5-(1,2,2-triphenylethenyl)benzene-1,3-dicarbaldehyde.
| Compound Name | 2-trimethylsilyloxy-5-(1,2,2-triphenylethenyl)benzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 163323298 |
| Molecular Formula | C31H28O3Si |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-trimethylsilyloxy-5-(1,2,2-triphenylethenyl)benzene-1,3-dicarbaldehyde |
| SMILES | C[Si](C)(C)Oc1c(C=O)cc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1C=O |
| InChI | InChI=1S/C31H28O3Si/c1-35(2,3)34-31-27(21-32)19-26(20-28(31)22-33)30(25-17-11-6-12-18-25)29(23-13-7-4-8-14-23)24-15-9-5-10-16-24/h4-22H,1-3H3 |
| InChIKey | MCJCSTSJPWEAOS-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|