C29H26O2Si — CID 132600535
dihydroxy-methyl-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]silane (PubChem CID 132600535) has the molecular formula C29H26O2Si and a molecular weight of 434.61 g/mol. Its IUPAC name is dihydroxy-methyl-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]silane.
| Compound Name | dihydroxy-methyl-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]silane |
|---|---|
| PubChem CID | 132600535 |
| Molecular Formula | C29H26O2Si |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | dihydroxy-methyl-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]silane |
| SMILES | C[Si](O)(O)/C=C/c1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26O2Si/c1-32(30,31)22-21-23-17-19-27(20-18-23)29(26-15-9-4-10-16-26)28(24-11-5-2-6-12-24)25-13-7-3-8-14-25/h2-22,30-31H,1H3/b22-21+ |
| InChIKey | CNQMZCNMXWQMMA-QURGRASLSA-N |
| XLogP | 6.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|