C29H31BrClN5O7S2 — CID 163326638
2-[4-[bis(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]-2-bromo-6-ethoxyphenoxy]-N-phenylacetamide;hydrochloride (PubChem CID 163326638) has the molecular formula C29H31BrClN5O7S2 and a molecular weight of 741.09 g/mol. Its IUPAC name is 2-[4-[bis(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]-2-bromo-6-ethoxyphenoxy]-N-phenylacetamide;hydrochloride.
| Compound Name | 2-[4-[bis(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]-2-bromo-6-ethoxyphenoxy]-N-phenylacetamide;hydrochloride |
|---|---|
| PubChem CID | 163326638 |
| Molecular Formula | C29H31BrClN5O7S2 |
| Molecular Weight | 741.09 g/mol |
| Exact Mass | 739.05 |
| IUPAC Name | 2-[4-[bis(1,3-dimethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methyl]-2-bromo-6-ethoxyphenoxy]-N-phenylacetamide;hydrochloride |
| SMILES | CCOc1cc(C(C2C(=O)N(C)C(=S)N(C)C2=O)C2C(=O)N(C)C(=S)N(C)C2=O)cc(Br)c1OCC(=O)Nc1ccccc1.Cl |
| InChI | InChI=1S/C29H30BrN5O7S2.ClH/c1-6-41-18-13-15(12-17(30)23(18)42-14-19(36)31-16-10-8-7-9-11-16)20(21-24(37)32(2)28(43)33(3)25(21)38)22-26(39)34(4)29(44)35(5)27(22)40;/h7-13,20-22H,6,14H2,1-5H3,(H,31,36);1H |
| InChIKey | OJXVYPBVVKONBT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.09 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|