C22H25N3O8 — CID 163327678
1-(2,3-dimethylphenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;oxalic acid (PubChem CID 163327678) has the molecular formula C22H25N3O8 and a molecular weight of 459.46 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;oxalic acid.
| Compound Name | 1-(2,3-dimethylphenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 163327678 |
| Molecular Formula | C22H25N3O8 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine;oxalic acid |
| SMILES | Cc1cccc(N2CCN(Cc3cc4c(cc3[N+](=O)[O-])OCO4)CC2)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H23N3O4.C2H2O4/c1-14-4-3-5-17(15(14)2)22-8-6-21(7-9-22)12-16-10-19-20(27-13-26-19)11-18(16)23(24)25;3-1(4)2(5)6/h3-5,10-11H,6-9,12-13H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | XYSWJZFBCOLSCM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|